C22H24N6O4S — CID 173488707
3-[amino-[4-[(1R)-1-(1-benzofuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 173488707) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is 3-[amino-[4-[(1R)-1-(1-benzofuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[amino-[4-[(1R)-1-(1-benzofuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 173488707 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 3-[amino-[4-[(1R)-1-(1-benzofuran-2-yl)propyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CC[C@@H](/N=c1\[nH][s+]([O-])nc1N(N)c1cccc(C(=O)N(C)C)c1O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H24N6O4S/c1-4-15(18-12-13-8-5-6-11-17(13)32-18)24-20-21(26-33(31)25-20)28(23)16-10-7-9-14(19(16)29)22(30)27(2)3/h5-12,15,29H,4,23H2,1-3H3,(H,24,25)/t15-,33?/m1/s1 |
| InChIKey | LIDYXLPPKXIVCX-FJNJALAMSA-N |
| XLogP | 3.35 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|