C19H24N6O4S — CID 142883634
3-[amino-[1-oxo-4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 142883634) has the molecular formula C19H24N6O4S and a molecular weight of 432.51 g/mol. Its IUPAC name is 3-[amino-[1-oxo-4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[amino-[1-oxo-4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142883634 |
| Molecular Formula | C19H24N6O4S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 3-[amino-[1-oxo-4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CC(C)c1coc(CNC2=NS(=O)N=C2N(N)c2cccc(C(=O)N(C)C)c2O)c1 |
| InChI | InChI=1S/C19H24N6O4S/c1-11(2)12-8-13(29-10-12)9-21-17-18(23-30(28)22-17)25(20)15-7-5-6-14(16(15)26)19(27)24(3)4/h5-8,10-11,26H,9,20H2,1-4H3,(H,21,22) |
| InChIKey | HZYKRFREFZQDKY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|