C10H7N3O4 — CID 135441895
2-hydroxyimino-2-(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)-1-phenylethanone (PubChem CID 135441895) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 2-hydroxyimino-2-(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)-1-phenylethanone.
| Compound Name | 2-hydroxyimino-2-(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 135441895 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-hydroxyimino-2-(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)-1-phenylethanone |
| SMILES | O=C(C(=NO)c1c[n+]([O-])on1)c1ccccc1 |
| InChI | InChI=1S/C10H7N3O4/c14-10(7-4-2-1-3-5-7)9(11-15)8-6-13(16)17-12-8/h1-6,15H |
| InChIKey | YPUSGNPKSIAPMX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|