C20H25NO3 — CID 135442472
3-hydroxy-5,5-dimethyl-4-(3-methylphenyl)-2-(C-methyl-N-prop-2-enoxycarbonimidoyl)cyclohex-2-en-1-one (PubChem CID 135442472) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-4-(3-methylphenyl)-2-(C-methyl-N-prop-2-enoxycarbonimidoyl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-4-(3-methylphenyl)-2-(C-methyl-N-prop-2-enoxycarbonimidoyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135442472 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-4-(3-methylphenyl)-2-(C-methyl-N-prop-2-enoxycarbonimidoyl)cyclohex-2-en-1-one |
| SMILES | C=CCON=C(C)C1=C(O)C(c2cccc(C)c2)C(C)(C)CC1=O |
| InChI | InChI=1S/C20H25NO3/c1-6-10-24-21-14(3)17-16(22)12-20(4,5)18(19(17)23)15-9-7-8-13(2)11-15/h6-9,11,18,23H,1,10,12H2,2-5H3 |
| InChIKey | PKGUSJOXEDZVGS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|