C24H20N2O2S — CID 135442850
(1E)-1-[(Z)-2-benzoyl-3-hydroxy-3-phenylprop-2-enylidene]-3-benzylthiourea (PubChem CID 135442850) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is (1E)-1-[(Z)-2-benzoyl-3-hydroxy-3-phenylprop-2-enylidene]-3-benzylthiourea.
| Compound Name | (1E)-1-[(Z)-2-benzoyl-3-hydroxy-3-phenylprop-2-enylidene]-3-benzylthiourea |
|---|---|
| PubChem CID | 135442850 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (1E)-1-[(Z)-2-benzoyl-3-hydroxy-3-phenylprop-2-enylidene]-3-benzylthiourea |
| SMILES | O=C(C(/C=N/C(=S)NCc1ccccc1)=C(\O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O2S/c27-22(19-12-6-2-7-13-19)21(23(28)20-14-8-3-9-15-20)17-26-24(29)25-16-18-10-4-1-5-11-18/h1-15,17,27H,16H2,(H,25,29)/b22-21-,26-17+ |
| InChIKey | YFCGAMKQHIHABE-GZHVDYRCSA-N |
| XLogP | 4.98 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|