C24H21NO3 — CID 135733094
(Z)-3-hydroxy-2-[2-(4-hydroxyphenyl)ethyliminomethyl]-1,3-diphenylprop-2-en-1-one (PubChem CID 135733094) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (Z)-3-hydroxy-2-[2-(4-hydroxyphenyl)ethyliminomethyl]-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-hydroxy-2-[2-(4-hydroxyphenyl)ethyliminomethyl]-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 135733094 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (Z)-3-hydroxy-2-[2-(4-hydroxyphenyl)ethyliminomethyl]-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(C(/C=N/CCc1ccc(O)cc1)=C(\O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO3/c26-21-13-11-18(12-14-21)15-16-25-17-22(23(27)19-7-3-1-4-8-19)24(28)20-9-5-2-6-10-20/h1-14,17,26-27H,15-16H2/b23-22-,25-17+ |
| InChIKey | BBAQMRUJWMHQCB-GZFXZKQZSA-N |
| XLogP | 4.86 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|