C26H24ClN3O4S — CID 135443243
2-[(2-chlorophenyl)methylsulfanyl]-5-(2,5-dimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135443243) has the molecular formula C26H24ClN3O4S and a molecular weight of 510.02 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-5-(2,5-dimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-5-(2,5-dimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135443243 |
| Molecular Formula | C26H24ClN3O4S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-5-(2,5-dimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1ccc(OC)c(C2C3=C(CCCC3=O)Nc3nc(SCc4ccccc4Cl)[nH]c(=O)c32)c1 |
| InChI | InChI=1S/C26H24ClN3O4S/c1-33-15-10-11-20(34-2)16(12-15)21-22-18(8-5-9-19(22)31)28-24-23(21)25(32)30-26(29-24)35-13-14-6-3-4-7-17(14)27/h3-4,6-7,10-12,21H,5,8-9,13H2,1-2H3,(H2,28,29,30,32) |
| InChIKey | GAUUCAOCMOUXDF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |