C24H19ClFN3O2S — CID 135935241
(5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3-fluorophenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135935241) has the molecular formula C24H19ClFN3O2S and a molecular weight of 467.95 g/mol. Its IUPAC name is (5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3-fluorophenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3-fluorophenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135935241 |
| Molecular Formula | C24H19ClFN3O2S |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3-fluorophenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1cccc(F)c1)c1c(nc(SCc3ccccc3Cl)[nH]c1=O)N2 |
| InChI | InChI=1S/C24H19ClFN3O2S/c25-16-8-2-1-5-14(16)12-32-24-28-22-21(23(31)29-24)19(13-6-3-7-15(26)11-13)20-17(27-22)9-4-10-18(20)30/h1-3,5-8,11,19H,4,9-10,12H2,(H2,27,28,29,31)/t19-/m1/s1 |
| InChIKey | OIAZJOCLDUCKSS-LJQANCHMSA-N |
| XLogP | 5.42 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |