C27H26ClN3O5S — CID 136862502
(5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136862502) has the molecular formula C27H26ClN3O5S and a molecular weight of 540.04 g/mol. Its IUPAC name is (5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136862502 |
| Molecular Formula | C27H26ClN3O5S |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | (5R)-2-[(2-chlorophenyl)methylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cc([C@@H]2C3=C(CCCC3=O)Nc3nc(SCc4ccccc4Cl)[nH]c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C27H26ClN3O5S/c1-34-19-11-15(12-20(35-2)24(19)36-3)21-22-17(9-6-10-18(22)32)29-25-23(21)26(33)31-27(30-25)37-13-14-7-4-5-8-16(14)28/h4-5,7-8,11-12,21H,6,9-10,13H2,1-3H3,(H2,29,30,31,33)/t21-/m1/s1 |
| InChIKey | IZEDTGGCHHNOGZ-OAQYLSRUSA-N |
| XLogP | 5.31 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |