C17H21N5O3 — CID 135443760
methyl 4-[(4E)-4-[(2-amino-6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]pentyl]benzoate (PubChem CID 135443760) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is methyl 4-[(4E)-4-[(2-amino-6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]pentyl]benzoate.
| Compound Name | methyl 4-[(4E)-4-[(2-amino-6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]pentyl]benzoate |
|---|---|
| PubChem CID | 135443760 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | methyl 4-[(4E)-4-[(2-amino-6-oxo-1H-pyrimidin-4-yl)hydrazinylidene]pentyl]benzoate |
| SMILES | COC(=O)c1ccc(CCC/C(C)=N/Nc2cc(=O)[nH]c(N)n2)cc1 |
| InChI | InChI=1S/C17H21N5O3/c1-11(21-22-14-10-15(23)20-17(18)19-14)4-3-5-12-6-8-13(9-7-12)16(24)25-2/h6-10H,3-5H2,1-2H3,(H4,18,19,20,22,23)/b21-11+ |
| InChIKey | QAKQBWPPCBJEJI-SRZZPIQSSA-N |
| XLogP | 1.95 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|