C13H19N5OS — CID 135445363
2,6-diamino-8-[2-(dimethylamino)ethylsulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135445363) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 2,6-diamino-8-[2-(dimethylamino)ethylsulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 2,6-diamino-8-[2-(dimethylamino)ethylsulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135445363 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2,6-diamino-8-[2-(dimethylamino)ethylsulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | CN(C)CCSCc1cc(N)cc2c(=O)[nH]c(N)nc12 |
| InChI | InChI=1S/C13H19N5OS/c1-18(2)3-4-20-7-8-5-9(14)6-10-11(8)16-13(15)17-12(10)19/h5-6H,3-4,7,14H2,1-2H3,(H3,15,16,17,19) |
| InChIKey | FDIXHXDLCOSDFY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|