C15H14N4OS — CID 135499790
2,6-diamino-8-(phenylsulfanylmethyl)-3H-quinazolin-4-one (PubChem CID 135499790) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 2,6-diamino-8-(phenylsulfanylmethyl)-3H-quinazolin-4-one.
| Compound Name | 2,6-diamino-8-(phenylsulfanylmethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135499790 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2,6-diamino-8-(phenylsulfanylmethyl)-3H-quinazolin-4-one |
| SMILES | Nc1cc(CSc2ccccc2)c2nc(N)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C15H14N4OS/c16-10-6-9(8-21-11-4-2-1-3-5-11)13-12(7-10)14(20)19-15(17)18-13/h1-7H,8,16H2,(H3,17,18,19,20) |
| InChIKey | BFQQUBLIUNMFTG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|