C14H16N4O — CID 135446126
7-amino-3-tert-butyl-2,5-dihydropyrazolo[4,3-c]quinolin-4-one (PubChem CID 135446126) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 7-amino-3-tert-butyl-2,5-dihydropyrazolo[4,3-c]quinolin-4-one.
| Compound Name | 7-amino-3-tert-butyl-2,5-dihydropyrazolo[4,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 135446126 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 7-amino-3-tert-butyl-2,5-dihydropyrazolo[4,3-c]quinolin-4-one |
| SMILES | CC(C)(C)c1[nH]nc2c1c(=O)[nH]c1cc(N)ccc12 |
| InChI | InChI=1S/C14H16N4O/c1-14(2,3)12-10-11(17-18-12)8-5-4-7(15)6-9(8)16-13(10)19/h4-6H,15H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | CXQBSJISFCGUGT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|