C16H18N4O — CID 159619510
7-amino-4-methyl-1H-quinolin-2-one;benzene-1,3-diamine (PubChem CID 159619510) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 7-amino-4-methyl-1H-quinolin-2-one;benzene-1,3-diamine.
| Compound Name | 7-amino-4-methyl-1H-quinolin-2-one;benzene-1,3-diamine |
|---|---|
| PubChem CID | 159619510 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 7-amino-4-methyl-1H-quinolin-2-one;benzene-1,3-diamine |
| SMILES | Cc1cc(=O)[nH]c2cc(N)ccc12.Nc1cccc(N)c1 |
| InChI | InChI=1S/C10H10N2O.C6H8N2/c1-6-4-10(13)12-9-5-7(11)2-3-8(6)9;7-5-2-1-3-6(8)4-5/h2-5H,11H2,1H3,(H,12,13);1-4H,7-8H2 |
| InChIKey | MNSFJYBOLXMAEP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|