C15H20N2O — CID 91459928
7-amino-3-(2,2-dimethylpropyl)-4-methyl-1H-quinolin-2-one (PubChem CID 91459928) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 7-amino-3-(2,2-dimethylpropyl)-4-methyl-1H-quinolin-2-one.
| Compound Name | 7-amino-3-(2,2-dimethylpropyl)-4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 91459928 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 7-amino-3-(2,2-dimethylpropyl)-4-methyl-1H-quinolin-2-one |
| SMILES | Cc1c(CC(C)(C)C)c(=O)[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C15H20N2O/c1-9-11-6-5-10(16)7-13(11)17-14(18)12(9)8-15(2,3)4/h5-7H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | XTKSYSILEFLGFX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|