C19H18N2O3 — CID 68543201
(1R,2S,6R,7S)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 68543201) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 68543201 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (1R,2S,6R,7S)-4-(4-methyl-2-oxo-1H-quinolin-7-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(=O)[nH]c2cc(N3C(=O)[C@@H]4[C@H]5CC[C@H](C5)[C@@H]4C3=O)ccc12 |
| InChI | InChI=1S/C19H18N2O3/c1-9-6-15(22)20-14-8-12(4-5-13(9)14)21-18(23)16-10-2-3-11(7-10)17(16)19(21)24/h4-6,8,10-11,16-17H,2-3,7H2,1H3,(H,20,22)/t10-,11+,16+,17- |
| InChIKey | XFJKGFGLMPJRPG-BRTARUFTSA-N |
| XLogP | 2.37 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|