C25H23N3O — CID 135447802
4-[4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzoxazepin-2-yl]-N,N-dimethylaniline (PubChem CID 135447802) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzoxazepin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzoxazepin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 135447802 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzoxazepin-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CC(c3c[nH]c4ccccc34)=Nc3ccccc3O2)cc1 |
| InChI | InChI=1S/C25H23N3O/c1-28(2)18-13-11-17(12-14-18)25-15-23(27-22-9-5-6-10-24(22)29-25)20-16-26-21-8-4-3-7-19(20)21/h3-14,16,25-26H,15H2,1-2H3 |
| InChIKey | LSAVXUACDZLFCI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|