C32H29ClN4S — CID 135531084
2-chloro-N-[[2-[4-(dimethylamino)phenyl]-4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzothiazepin-3-yl]methyl]aniline (PubChem CID 135531084) has the molecular formula C32H29ClN4S and a molecular weight of 537.13 g/mol. Its IUPAC name is 2-chloro-N-[[2-[4-(dimethylamino)phenyl]-4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzothiazepin-3-yl]methyl]aniline.
| Compound Name | 2-chloro-N-[[2-[4-(dimethylamino)phenyl]-4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzothiazepin-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 135531084 |
| Molecular Formula | C32H29ClN4S |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 2-chloro-N-[[2-[4-(dimethylamino)phenyl]-4-(1H-indol-3-yl)-2,3-dihydro-1,5-benzothiazepin-3-yl]methyl]aniline |
| SMILES | CN(C)c1ccc(C2Sc3ccccc3N=C(c3c[nH]c4ccccc34)C2CNc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C32H29ClN4S/c1-37(2)22-17-15-21(16-18-22)32-25(20-35-28-12-6-4-10-26(28)33)31(36-29-13-7-8-14-30(29)38-32)24-19-34-27-11-5-3-9-23(24)27/h3-19,25,32,34-35H,20H2,1-2H3 |
| InChIKey | ZTGCEZYHOYFVCQ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|