C13H14N2 — CID 137097329
3-[(4R)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]-1H-indole (PubChem CID 137097329) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-[(4R)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]-1H-indole.
| Compound Name | 3-[(4R)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]-1H-indole |
|---|---|
| PubChem CID | 137097329 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-[(4R)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]-1H-indole |
| SMILES | C[C@@H]1CCN=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H14N2/c1-9-6-7-14-13(9)11-8-15-12-5-3-2-4-10(11)12/h2-5,8-9,15H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | QGDOERJZOMIDJT-SECBINFHSA-N |
| XLogP | 3.00 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |