C17H15N3 — CID 27783
5-(1H-indol-3-yl)-2,3-dihydro-1H-1,4-benzodiazepine (PubChem CID 27783) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-2,3-dihydro-1H-1,4-benzodiazepine.
| Compound Name | 5-(1H-indol-3-yl)-2,3-dihydro-1H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 27783 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-(1H-indol-3-yl)-2,3-dihydro-1H-1,4-benzodiazepine |
| SMILES | c1ccc2c(c1)NCCN=C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H15N3/c1-3-7-15-12(5-1)14(11-20-15)17-13-6-2-4-8-16(13)18-9-10-19-17/h1-8,11,18,20H,9-10H2 |
| InChIKey | NKGNYANHMDCHRL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |