C30H24N4OS — CID 135533301
[4-(1H-indol-3-yl)-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]-phenyldiazene (PubChem CID 135533301) has the molecular formula C30H24N4OS and a molecular weight of 488.62 g/mol. Its IUPAC name is [4-(1H-indol-3-yl)-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]-phenyldiazene.
| Compound Name | [4-(1H-indol-3-yl)-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]-phenyldiazene |
|---|---|
| PubChem CID | 135533301 |
| Molecular Formula | C30H24N4OS |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [4-(1H-indol-3-yl)-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]-phenyldiazene |
| SMILES | COc1ccc(C2Sc3ccccc3N=C(c3c[nH]c4ccccc34)C2/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N4OS/c1-35-22-17-15-20(16-18-22)30-29(34-33-21-9-3-2-4-10-21)28(32-26-13-7-8-14-27(26)36-30)24-19-31-25-12-6-5-11-23(24)25/h2-19,29-31H,1H3/b34-33+ |
| InChIKey | YFGOYGXILPDZTD-JEIPZWNWSA-N |
| XLogP | 8.30 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|