C10H11N3OS — CID 135452280
4,6-dimethyl-11-thia-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-trien-8-one (PubChem CID 135452280) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 4,6-dimethyl-11-thia-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-trien-8-one.
| Compound Name | 4,6-dimethyl-11-thia-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-trien-8-one |
|---|---|
| PubChem CID | 135452280 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4,6-dimethyl-11-thia-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5-trien-8-one |
| SMILES | Cc1nn(C)c2[nH]c3c(c(=O)c12)CSC3 |
| InChI | InChI=1S/C10H11N3OS/c1-5-8-9(14)6-3-15-4-7(6)11-10(8)13(2)12-5/h3-4H2,1-2H3,(H,11,14) |
| InChIKey | ZWNLFVIBRHFZCW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |