C19H26N6O2 — CID 135452734
1-cyclohexyl-3-[N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]urea (PubChem CID 135452734) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]urea.
| Compound Name | 1-cyclohexyl-3-[N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135452734 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-cyclohexyl-3-[N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]urea |
| SMILES | CCOc1ccc2nc(N=C(N)NC(=O)NC3CCCCC3)nc(C)c2c1 |
| InChI | InChI=1S/C19H26N6O2/c1-3-27-14-9-10-16-15(11-14)12(2)21-18(23-16)24-17(20)25-19(26)22-13-7-5-4-6-8-13/h9-11,13H,3-8H2,1-2H3,(H4,20,21,22,23,24,25,26) |
| InChIKey | MOZQIAMZXNYLBU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|