C20H22N5O2+ — CID 135960932
(E)-[amino-[(4-methylbenzoyl)amino]methylidene]-(6-ethoxy-4-methylquinazolin-2-yl)azanium (PubChem CID 135960932) has the molecular formula C20H22N5O2+ and a molecular weight of 364.43 g/mol. Its IUPAC name is (E)-[amino-[(4-methylbenzoyl)amino]methylidene]-(6-ethoxy-4-methylquinazolin-2-yl)azanium.
| Compound Name | (E)-[amino-[(4-methylbenzoyl)amino]methylidene]-(6-ethoxy-4-methylquinazolin-2-yl)azanium |
|---|---|
| PubChem CID | 135960932 |
| Molecular Formula | C20H22N5O2+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (E)-[amino-[(4-methylbenzoyl)amino]methylidene]-(6-ethoxy-4-methylquinazolin-2-yl)azanium |
| SMILES | CCOc1ccc2nc(/[NH+]=C(\N)NC(=O)c3ccc(C)cc3)nc(C)c2c1 |
| InChI | InChI=1S/C20H21N5O2/c1-4-27-15-9-10-17-16(11-15)13(3)22-20(23-17)25-19(21)24-18(26)14-7-5-12(2)6-8-14/h5-11H,4H2,1-3H3,(H3,21,22,23,24,25,26)/p+1 |
| InChIKey | DLVGLGBWYAHNJY-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|