C24H26N6O4 — CID 135643695
ethyl (E)-2-[(E)-N'-[(E)-N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 135643695) has the molecular formula C24H26N6O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is ethyl (E)-2-[(E)-N'-[(E)-N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-2-[(E)-N'-[(E)-N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135643695 |
| Molecular Formula | C24H26N6O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | ethyl (E)-2-[(E)-N'-[(E)-N'-(6-ethoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C(N)=N\C(N)=N\c1nc(C)c2cc(OCC)ccc2n1)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C24H26N6O4/c1-4-33-16-11-12-18-17(13-16)14(3)27-24(28-18)30-23(26)29-21(25)19(22(32)34-5-2)20(31)15-9-7-6-8-10-15/h6-13,31H,4-5H2,1-3H3,(H4,25,26,27,28,29,30)/b20-19+ |
| InChIKey | MREOTFFKJONXLR-FMQUCBEESA-N |
| XLogP | 3.17 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|