C23H24N6O4 — CID 135520920
ethyl 3-hydroxy-2-[N'-[N'-(6-methoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-phenylprop-2-enoate (PubChem CID 135520920) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[N'-[N'-(6-methoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-phenylprop-2-enoate.
| Compound Name | ethyl 3-hydroxy-2-[N'-[N'-(6-methoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135520920 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | ethyl 3-hydroxy-2-[N'-[N'-(6-methoxy-4-methylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(C(N)=NC(N)=Nc1nc(C)c2cc(OC)ccc2n1)=C(O)c1ccccc1 |
| InChI | InChI=1S/C23H24N6O4/c1-4-33-21(31)18(19(30)14-8-6-5-7-9-14)20(24)28-22(25)29-23-26-13(2)16-12-15(32-3)10-11-17(16)27-23/h5-12,30H,4H2,1-3H3,(H4,24,25,26,27,28,29) |
| InChIKey | KKKVBILSPNLHKB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|