C23H24N6O3 — CID 135907578
ethyl (Z)-2-[(Z)-N'-[(E)-N'-(4,7-dimethylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 135907578) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl (Z)-2-[(Z)-N'-[(E)-N'-(4,7-dimethylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(Z)-N'-[(E)-N'-(4,7-dimethylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135907578 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | ethyl (Z)-2-[(Z)-N'-[(E)-N'-(4,7-dimethylquinazolin-2-yl)carbamimidoyl]carbamimidoyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C(N)=N/C(N)=N/c1nc(C)c2ccc(C)cc2n1)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C23H24N6O3/c1-4-32-21(31)18(19(30)15-8-6-5-7-9-15)20(24)28-22(25)29-23-26-14(3)16-11-10-13(2)12-17(16)27-23/h5-12,30H,4H2,1-3H3,(H4,24,25,26,27,28,29)/b19-18- |
| InChIKey | FVRIIBSAKMJYIC-HNENSFHCSA-N |
| XLogP | 3.08 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|