C20H23N6O2S+ — CID 2012445
[amino-[(6-ethoxy-4-methylquinazolin-2-yl)amino]methylidene]-[(3-methoxyphenyl)carbamothioyl]azanium (PubChem CID 2012445) has the molecular formula C20H23N6O2S+ and a molecular weight of 411.51 g/mol. Its IUPAC name is [amino-[(6-ethoxy-4-methylquinazolin-2-yl)amino]methylidene]-[(3-methoxyphenyl)carbamothioyl]azanium.
| Compound Name | [amino-[(6-ethoxy-4-methylquinazolin-2-yl)amino]methylidene]-[(3-methoxyphenyl)carbamothioyl]azanium |
|---|---|
| PubChem CID | 2012445 |
| Molecular Formula | C20H23N6O2S+ |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [amino-[(6-ethoxy-4-methylquinazolin-2-yl)amino]methylidene]-[(3-methoxyphenyl)carbamothioyl]azanium |
| SMILES | CCOc1ccc2nc(NC(N)=[NH+]C(=S)Nc3cccc(OC)c3)nc(C)c2c1 |
| InChI | InChI=1S/C20H22N6O2S/c1-4-28-15-8-9-17-16(11-15)12(2)22-19(24-17)25-18(21)26-20(29)23-13-6-5-7-14(10-13)27-3/h5-11H,4H2,1-3H3,(H4,21,22,23,24,25,26,29)/p+1 |
| InChIKey | ZVQFHESFSLLHPK-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|