C19H20N6S — CID 2017668
1-[amino-[(4,6-dimethylquinazolin-2-yl)amino]methylidene]-3-(3-methylphenyl)thiourea (PubChem CID 2017668) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is 1-[amino-[(4,6-dimethylquinazolin-2-yl)amino]methylidene]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[amino-[(4,6-dimethylquinazolin-2-yl)amino]methylidene]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 2017668 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[amino-[(4,6-dimethylquinazolin-2-yl)amino]methylidene]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N=C(N)Nc2nc(C)c3cc(C)ccc3n2)c1 |
| InChI | InChI=1S/C19H20N6S/c1-11-5-4-6-14(9-11)22-19(26)25-17(20)24-18-21-13(3)15-10-12(2)7-8-16(15)23-18/h4-10H,1-3H3,(H4,20,21,22,23,24,25,26) |
| InChIKey | SZEAPMQKQDLLFN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|