C18H18N5O+ — CID 4128918
[amino(benzamido)methylidene]-(4,7-dimethylquinazolin-2-yl)azanium (PubChem CID 4128918) has the molecular formula C18H18N5O+ and a molecular weight of 320.38 g/mol. Its IUPAC name is [amino(benzamido)methylidene]-(4,7-dimethylquinazolin-2-yl)azanium.
| Compound Name | [amino(benzamido)methylidene]-(4,7-dimethylquinazolin-2-yl)azanium |
|---|---|
| PubChem CID | 4128918 |
| Molecular Formula | C18H18N5O+ |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [amino(benzamido)methylidene]-(4,7-dimethylquinazolin-2-yl)azanium |
| SMILES | Cc1ccc2c(C)nc([NH+]=C(N)NC(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C18H17N5O/c1-11-8-9-14-12(2)20-18(21-15(14)10-11)23-17(19)22-16(24)13-6-4-3-5-7-13/h3-10H,1-2H3,(H3,19,20,21,22,23,24)/p+1 |
| InChIKey | TZFZNJKEMHNUFJ-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|