C18H14N6O2 — CID 135453236
2-amino-4-anilino-1-[(E)-(2-hydroxyphenyl)methylideneamino]-6-oxopyrimidine-5-carbonitrile (PubChem CID 135453236) has the molecular formula C18H14N6O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-amino-4-anilino-1-[(E)-(2-hydroxyphenyl)methylideneamino]-6-oxopyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-anilino-1-[(E)-(2-hydroxyphenyl)methylideneamino]-6-oxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135453236 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-amino-4-anilino-1-[(E)-(2-hydroxyphenyl)methylideneamino]-6-oxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)nc(N)n(/N=C/c2ccccc2O)c1=O |
| InChI | InChI=1S/C18H14N6O2/c19-10-14-16(22-13-7-2-1-3-8-13)23-18(20)24(17(14)26)21-11-12-6-4-5-9-15(12)25/h1-9,11,22,25H,(H2,20,23)/b21-11+ |
| InChIKey | NVBPZCQGXDYEPB-SRZZPIQSSA-N |
| XLogP | 2.03 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|