C24H28N4O4 — CID 135453449
7-[2-(cyclopropylmethoxy)-6-hydroxyphenyl]-2-oxo-5-piperidin-3-yl-3,4-dihydro-1H-1,8-naphthyridine-3-carboxamide (PubChem CID 135453449) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 7-[2-(cyclopropylmethoxy)-6-hydroxyphenyl]-2-oxo-5-piperidin-3-yl-3,4-dihydro-1H-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-[2-(cyclopropylmethoxy)-6-hydroxyphenyl]-2-oxo-5-piperidin-3-yl-3,4-dihydro-1H-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 135453449 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 7-[2-(cyclopropylmethoxy)-6-hydroxyphenyl]-2-oxo-5-piperidin-3-yl-3,4-dihydro-1H-1,8-naphthyridine-3-carboxamide |
| SMILES | NC(=O)C1Cc2c(C3CCCNC3)cc(-c3c(O)cccc3OCC3CC3)nc2NC1=O |
| InChI | InChI=1S/C24H28N4O4/c25-22(30)17-9-16-15(14-3-2-8-26-11-14)10-18(27-23(16)28-24(17)31)21-19(29)4-1-5-20(21)32-12-13-6-7-13/h1,4-5,10,13-14,17,26,29H,2-3,6-9,11-12H2,(H2,25,30)(H,27,28,31) |
| InChIKey | AYEHKYACNQAKGD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|