C16H11Br2NO3S — CID 135453484
3,6-dibromo-4-[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol (PubChem CID 135453484) has the molecular formula C16H11Br2NO3S and a molecular weight of 457.14 g/mol. Its IUPAC name is 3,6-dibromo-4-[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol.
| Compound Name | 3,6-dibromo-4-[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135453484 |
| Molecular Formula | C16H11Br2NO3S |
| Molecular Weight | 457.14 g/mol |
| Exact Mass | 454.88 |
| IUPAC Name | 3,6-dibromo-4-[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]benzene-1,2-diol |
| SMILES | COc1cccc(-c2cnc(-c3cc(Br)c(O)c(O)c3Br)s2)c1 |
| InChI | InChI=1S/C16H11Br2NO3S/c1-22-9-4-2-3-8(5-9)12-7-19-16(23-12)10-6-11(17)14(20)15(21)13(10)18/h2-7,20-21H,1H3 |
| InChIKey | NEDZRBMUCWXBGI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.14 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|