C16H14NO2S- — CID 91928076
cyclopenta-1,4-dien-1-yl-[2-(3-methoxyphenyl)-1,3-thiazol-5-yl]methanol (PubChem CID 91928076) has the molecular formula C16H14NO2S- and a molecular weight of 284.36 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl-[2-(3-methoxyphenyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | cyclopenta-1,4-dien-1-yl-[2-(3-methoxyphenyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 91928076 |
| Molecular Formula | C16H14NO2S- |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl-[2-(3-methoxyphenyl)-1,3-thiazol-5-yl]methanol |
| SMILES | COc1cccc(-c2ncc(C(O)c3cc[cH-]c3)s2)c1 |
| InChI | InChI=1S/C16H14NO2S/c1-19-13-8-4-7-12(9-13)16-17-10-14(20-16)15(18)11-5-2-3-6-11/h2-10,15,18H,1H3/q-1 |
| InChIKey | BICZKHIXQFCUKY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|