C24H27N3O3S — CID 135453707
2-[(4-methylphenyl)methyl]-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135453707) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-methylphenyl)methyl]-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135453707 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(Cc2nc3c(c(=O)[nH]2)CN(S(=O)(=O)c2c(C)cc(C)cc2C)CC3)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-15-5-7-19(8-6-15)13-22-25-21-9-10-27(14-20(21)24(28)26-22)31(29,30)23-17(3)11-16(2)12-18(23)4/h5-8,11-12H,9-10,13-14H2,1-4H3,(H,25,26,28) |
| InChIKey | KBGAUSVMYPIWOV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |