C12H21N5O2 — CID 135453909
1-[4-(dimethylamino)-6-oxo-1H-pyrimidin-5-yl]-3-pentylurea (PubChem CID 135453909) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-6-oxo-1H-pyrimidin-5-yl]-3-pentylurea.
| Compound Name | 1-[4-(dimethylamino)-6-oxo-1H-pyrimidin-5-yl]-3-pentylurea |
|---|---|
| PubChem CID | 135453909 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-[4-(dimethylamino)-6-oxo-1H-pyrimidin-5-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1c(N(C)C)nc[nH]c1=O |
| InChI | InChI=1S/C12H21N5O2/c1-4-5-6-7-13-12(19)16-9-10(17(2)3)14-8-15-11(9)18/h8H,4-7H2,1-3H3,(H2,13,16,19)(H,14,15,18) |
| InChIKey | GJIUFVHLCQQMJE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|