C12H19N5O4 — CID 122087086
4-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]butanoic acid (PubChem CID 122087086) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122087086 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]butanoic acid |
| SMILES | COc1ncnc(N(C)C)c1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H19N5O4/c1-17(2)10-9(11(21-3)15-7-14-10)16-12(20)13-6-4-5-8(18)19/h7H,4-6H2,1-3H3,(H,18,19)(H2,13,16,20) |
| InChIKey | XVVRSYAAVUTGRN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|