C17H21N5O4 — CID 122087096
3-[3-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]phenyl]propanoic acid (PubChem CID 122087096) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-[3-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122087096 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-[3-[[4-(dimethylamino)-6-methoxypyrimidin-5-yl]carbamoylamino]phenyl]propanoic acid |
| SMILES | COc1ncnc(N(C)C)c1NC(=O)Nc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C17H21N5O4/c1-22(2)15-14(16(26-3)19-10-18-15)21-17(25)20-12-6-4-5-11(9-12)7-8-13(23)24/h4-6,9-10H,7-8H2,1-3H3,(H,23,24)(H2,20,21,25) |
| InChIKey | YORUWZDHJSBKRX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |