C22H17FN4O4 — CID 135454264
6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 135454264) has the molecular formula C22H17FN4O4 and a molecular weight of 420.40 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 135454264 |
| Molecular Formula | C22H17FN4O4 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 6-[(4-fluorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c2c(O)c(/C=N/c3ccc(F)cc3)c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C22H17FN4O4/c1-25-19-17(21(30)26(2)22(25)31)18(28)16(12-24-14-10-8-13(23)9-11-14)20(29)27(19)15-6-4-3-5-7-15/h3-12,28H,1-2H3/b24-12+ |
| InChIKey | UZCACWPZEOTYQH-WYMPLXKRSA-N |
| XLogP | 1.98 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|