C33H26N5O5P — CID 2777930
1,3-dimethyl-6-nitro-8-phenyl-5-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 2777930) has the molecular formula C33H26N5O5P and a molecular weight of 603.58 g/mol. Its IUPAC name is 1,3-dimethyl-6-nitro-8-phenyl-5-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,3-dimethyl-6-nitro-8-phenyl-5-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 2777930 |
| Molecular Formula | C33H26N5O5P |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | 1,3-dimethyl-6-nitro-8-phenyl-5-[(triphenyl-lambda5-phosphanylidene)amino]pyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c2c(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)c([N+](=O)[O-])c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C33H26N5O5P/c1-35-30-27(31(39)36(2)33(35)41)28(29(38(42)43)32(40)37(30)23-15-7-3-8-16-23)34-44(24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | CVSLGQCFLKCMBR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 121.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|