C19H9F3N4OS2 — CID 135455823
4-pyridin-4-yl-13-thiophen-2-yl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 135455823) has the molecular formula C19H9F3N4OS2 and a molecular weight of 430.44 g/mol. Its IUPAC name is 4-pyridin-4-yl-13-thiophen-2-yl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 4-pyridin-4-yl-13-thiophen-2-yl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 135455823 |
| Molecular Formula | C19H9F3N4OS2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 4-pyridin-4-yl-13-thiophen-2-yl-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | O=c1[nH]c(-c2ccncc2)nc2c1sc1nc(C(F)(F)F)cc(-c3cccs3)c12 |
| InChI | InChI=1S/C19H9F3N4OS2/c20-19(21,22)12-8-10(11-2-1-7-28-11)13-14-15(29-18(13)24-12)17(27)26-16(25-14)9-3-5-23-6-4-9/h1-8H,(H,25,26,27) |
| InChIKey | IXOGVBLUFGJVGJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |