C14H6F3N3O2S — CID 135646612
13-(furan-2-yl)-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 135646612) has the molecular formula C14H6F3N3O2S and a molecular weight of 337.28 g/mol. Its IUPAC name is 13-(furan-2-yl)-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 13-(furan-2-yl)-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 135646612 |
| Molecular Formula | C14H6F3N3O2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 13-(furan-2-yl)-11-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | O=c1[nH]cnc2c1sc1nc(C(F)(F)F)cc(-c3ccco3)c12 |
| InChI | InChI=1S/C14H6F3N3O2S/c15-14(16,17)8-4-6(7-2-1-3-22-7)9-10-11(23-13(9)20-8)12(21)19-5-18-10/h1-5H,(H,18,19,21) |
| InChIKey | HXMIJXIJDFPALA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |