C16H12N4O2S — CID 135654311
11-(4-methoxyphenyl)-13-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 135654311) has the molecular formula C16H12N4O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-13-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 11-(4-methoxyphenyl)-13-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 135654311 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 11-(4-methoxyphenyl)-13-methyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | COc1ccc(-c2nc(C)c3c(n2)sc2c(=O)[nH]cnc23)cc1 |
| InChI | InChI=1S/C16H12N4O2S/c1-8-11-12-13(15(21)18-7-17-12)23-16(11)20-14(19-8)9-3-5-10(22-2)6-4-9/h3-7H,1-2H3,(H,17,18,21) |
| InChIKey | GCXSDDJERVYKFH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |