C14H12F3N3OS — CID 135407581
11-tert-butyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 135407581) has the molecular formula C14H12F3N3OS and a molecular weight of 327.33 g/mol. Its IUPAC name is 11-tert-butyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11-tert-butyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 135407581 |
| Molecular Formula | C14H12F3N3OS |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 11-tert-butyl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)c2c(n1)sc1c(=O)[nH]cnc12 |
| InChI | InChI=1S/C14H12F3N3OS/c1-13(2,3)7-4-6(14(15,16)17)8-9-10(22-12(8)20-7)11(21)19-5-18-9/h4-5H,1-3H3,(H,18,19,21) |
| InChIKey | WYAJCCNZVKKLHX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |