C17H15F3N4OS2 — CID 19615499
4-(butylamino)-11-methyl-13-(trifluoromethyl)-5,16-dithia-3,8,14-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10(15),11,13-hexaen-7-one (PubChem CID 19615499) has the molecular formula C17H15F3N4OS2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-(butylamino)-11-methyl-13-(trifluoromethyl)-5,16-dithia-3,8,14-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10(15),11,13-hexaen-7-one.
| Compound Name | 4-(butylamino)-11-methyl-13-(trifluoromethyl)-5,16-dithia-3,8,14-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10(15),11,13-hexaen-7-one |
|---|---|
| PubChem CID | 19615499 |
| Molecular Formula | C17H15F3N4OS2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-(butylamino)-11-methyl-13-(trifluoromethyl)-5,16-dithia-3,8,14-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10(15),11,13-hexaen-7-one |
| SMILES | CCCCNc1nc2c(s1)c(=O)[nH]c1c2sc2nc(C(F)(F)F)cc(C)c21 |
| InChI | InChI=1S/C17H15F3N4OS2/c1-3-4-5-21-16-24-11-12-10(23-14(25)13(11)27-16)9-7(2)6-8(17(18,19)20)22-15(9)26-12/h6H,3-5H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | RRQYLYYKJNSTSQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|