C23H16F4N4OS — CID 91263568
8-fluoro-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-10H-[1,3]thiazolo[4,5-c][1,8]phenanthrolin-11-one (PubChem CID 91263568) has the molecular formula C23H16F4N4OS and a molecular weight of 472.47 g/mol. Its IUPAC name is 8-fluoro-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-10H-[1,3]thiazolo[4,5-c][1,8]phenanthrolin-11-one.
| Compound Name | 8-fluoro-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-10H-[1,3]thiazolo[4,5-c][1,8]phenanthrolin-11-one |
|---|---|
| PubChem CID | 91263568 |
| Molecular Formula | C23H16F4N4OS |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 8-fluoro-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-10H-[1,3]thiazolo[4,5-c][1,8]phenanthrolin-11-one |
| SMILES | O=c1[nH]c2c3cc(F)ncc3ccc2c2sc(NCCCc3ccc(C(F)(F)F)cc3)nc12 |
| InChI | InChI=1S/C23H16F4N4OS/c24-17-10-16-13(11-29-17)5-8-15-18(16)30-21(32)19-20(15)33-22(31-19)28-9-1-2-12-3-6-14(7-4-12)23(25,26)27/h3-8,10-11H,1-2,9H2,(H,28,31)(H,30,32) |
| InChIKey | DNQJYOFSEZJJLR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|