C25H22F3N3O2S — CID 89344504
5-[4-(3-hydroxybut-1-ynyl)-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-1,3-thiazol-5-yl]-1,3-dihydroindol-2-one (PubChem CID 89344504) has the molecular formula C25H22F3N3O2S and a molecular weight of 485.53 g/mol. Its IUPAC name is 5-[4-(3-hydroxybut-1-ynyl)-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-1,3-thiazol-5-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-(3-hydroxybut-1-ynyl)-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-1,3-thiazol-5-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 89344504 |
| Molecular Formula | C25H22F3N3O2S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 5-[4-(3-hydroxybut-1-ynyl)-2-[3-[4-(trifluoromethyl)phenyl]propylamino]-1,3-thiazol-5-yl]-1,3-dihydroindol-2-one |
| SMILES | CC(O)C#Cc1nc(NCCCc2ccc(C(F)(F)F)cc2)sc1-c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C25H22F3N3O2S/c1-15(32)4-10-21-23(17-7-11-20-18(13-17)14-22(33)30-20)34-24(31-21)29-12-2-3-16-5-8-19(9-6-16)25(26,27)28/h5-9,11,13,15,32H,2-3,12,14H2,1H3,(H,29,31)(H,30,33) |
| InChIKey | IAVDRMDXSAVDBL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|