C29H22F5N3S — CID 143508715
4-(3,4-difluorophenyl)-5-isoquinolin-6-yl-N-[4-[4-(trifluoromethyl)phenyl]butyl]-1,3-thiazol-2-amine (PubChem CID 143508715) has the molecular formula C29H22F5N3S and a molecular weight of 539.57 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-5-isoquinolin-6-yl-N-[4-[4-(trifluoromethyl)phenyl]butyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-difluorophenyl)-5-isoquinolin-6-yl-N-[4-[4-(trifluoromethyl)phenyl]butyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143508715 |
| Molecular Formula | C29H22F5N3S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 4-(3,4-difluorophenyl)-5-isoquinolin-6-yl-N-[4-[4-(trifluoromethyl)phenyl]butyl]-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(-c2nc(NCCCCc3ccc(C(F)(F)F)cc3)sc2-c2ccc3cnccc3c2)cc1F |
| InChI | InChI=1S/C29H22F5N3S/c30-24-11-8-20(16-25(24)31)26-27(21-6-7-22-17-35-14-12-19(22)15-21)38-28(37-26)36-13-2-1-3-18-4-9-23(10-5-18)29(32,33)34/h4-12,14-17H,1-3,13H2,(H,36,37) |
| InChIKey | MMQLDDQPRGNDGL-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|