C21H20N4OS — CID 143747579
5-isoquinolin-6-yl-N-[3-(4-methoxyphenyl)propyl]-1,2,4-thiadiazol-3-amine (PubChem CID 143747579) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 5-isoquinolin-6-yl-N-[3-(4-methoxyphenyl)propyl]-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-isoquinolin-6-yl-N-[3-(4-methoxyphenyl)propyl]-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 143747579 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-isoquinolin-6-yl-N-[3-(4-methoxyphenyl)propyl]-1,2,4-thiadiazol-3-amine |
| SMILES | COc1ccc(CCCNc2nsc(-c3ccc4cnccc4c3)n2)cc1 |
| InChI | InChI=1S/C21H20N4OS/c1-26-19-8-4-15(5-9-19)3-2-11-23-21-24-20(27-25-21)17-6-7-18-14-22-12-10-16(18)13-17/h4-10,12-14H,2-3,11H2,1H3,(H,23,25) |
| InChIKey | CMHJCLWHJZRACE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|