C19H17N3O2S3 — CID 163511974
6-(hexylamino)-14-methyl-7,10,13-trithia-5,15-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dione (PubChem CID 163511974) has the molecular formula C19H17N3O2S3 and a molecular weight of 415.57 g/mol. Its IUPAC name is 6-(hexylamino)-14-methyl-7,10,13-trithia-5,15-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dione.
| Compound Name | 6-(hexylamino)-14-methyl-7,10,13-trithia-5,15-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dione |
|---|---|
| PubChem CID | 163511974 |
| Molecular Formula | C19H17N3O2S3 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 6-(hexylamino)-14-methyl-7,10,13-trithia-5,15-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dione |
| SMILES | CCCCCCNc1nc2c(=O)c3c(sc4c5sc(C)nc5c(=O)c43)c2s1 |
| InChI | InChI=1S/C19H17N3O2S3/c1-3-4-5-6-7-20-19-22-12-14(24)10-9-13(23)11-17(25-8(2)21-11)15(9)26-16(10)18(12)27-19/h3-7H2,1-2H3,(H,20,22) |
| InChIKey | DDLMSCHDSNLQMS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|